C9H10N2O3 — CID 131098139
[(1S)-7-nitro-2,3-dihydro-1H-isoindol-1-yl]methanol (PubChem CID 131098139) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is [(1S)-7-nitro-2,3-dihydro-1H-isoindol-1-yl]methanol.
| Compound Name | [(1S)-7-nitro-2,3-dihydro-1H-isoindol-1-yl]methanol |
|---|---|
| PubChem CID | 131098139 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | [(1S)-7-nitro-2,3-dihydro-1H-isoindol-1-yl]methanol |
| SMILES | O=[N+]([O-])c1cccc2c1[C@@H](CO)NC2 |
| InChI | InChI=1S/C9H10N2O3/c12-5-7-9-6(4-10-7)2-1-3-8(9)11(13)14/h1-3,7,10,12H,4-5H2/t7-/m1/s1 |
| InChIKey | SLBLCIMMMXWMFE-SSDOTTSWSA-N |
| XLogP | 0.73 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|