C9H10N2O2 — CID 57309014
1-(nitromethyl)-2,3-dihydro-1H-isoindole (PubChem CID 57309014) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 1-(nitromethyl)-2,3-dihydro-1H-isoindole.
| Compound Name | 1-(nitromethyl)-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 57309014 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 1-(nitromethyl)-2,3-dihydro-1H-isoindole |
| SMILES | O=[N+]([O-])CC1NCc2ccccc21 |
| InChI | InChI=1S/C9H10N2O2/c12-11(13)6-9-8-4-2-1-3-7(8)5-10-9/h1-4,9-10H,5-6H2 |
| InChIKey | MMWOFLBVLGKFLU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|