About (6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol;hydrochloride
(6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol;hydrochloride (PubChem CID 136576225) has the molecular formula C9H11BrClNO2
and a molecular weight of 280.55 g/mol. Its IUPAC name is (6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol;hydrochloride.
Molecular Properties
| Compound Name | (6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol;hydrochloride |
| PubChem CID | 136576225 |
| Molecular Formula | C9H11BrClNO2 |
| Molecular Weight | 280.55 g/mol |
| Exact Mass | 278.97 |
| IUPAC Name | (6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol;hydrochloride |
| SMILES | Cl.OCC1CNc2cc(Br)ccc2O1 |
| InChI | InChI=1S/C9H10BrNO2.ClH/c10-6-1-2-9-8(3-6)11-4-7(5-12)13-9;/h1-3,7,11-12H,4-5H2;1H |
| InChIKey | GSTZTWKNZWGNFS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.55 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol;hydrochloride?
The IUPAC name of (6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol;hydrochloride (CID 136576225) is (6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol;hydrochloride.
What is the SMILES notation for (6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol;hydrochloride?
The canonical SMILES for (6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol;hydrochloride is Cl.OCC1CNc2cc(Br)ccc2O1.
What is the InChIKey of (6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol;hydrochloride?
The InChIKey is GSTZTWKNZWGNFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrNO2.ClH/c10-6-1-2-9-8(3-6)11-4-7(5-12)13-9;/h1-3,7,11-12H,4-5H2;1H.
What are the key properties of (6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol;hydrochloride?
(6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol;hydrochloride has a molecular weight of 280.55 g/mol, XLogP of 2.04, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol;hydrochloride is sourced from PubChem (CID 136576225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).