C10H13NO2 — CID 83816817
(8-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol (PubChem CID 83816817) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (8-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol.
| Compound Name | (8-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol |
|---|---|
| PubChem CID | 83816817 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (8-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)methanol |
| SMILES | Cc1cccc2c1OC(CO)CN2 |
| InChI | InChI=1S/C10H13NO2/c1-7-3-2-4-9-10(7)13-8(6-12)5-11-9/h2-4,8,11-12H,5-6H2,1H3 |
| InChIKey | LYWQWBVOIXRSIX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |