C10H12ClNO — CID 94975883
(2S)-8-chloro-2-ethyl-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 94975883) has the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. Its IUPAC name is (2S)-8-chloro-2-ethyl-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | (2S)-8-chloro-2-ethyl-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 94975883 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.66 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | (2S)-8-chloro-2-ethyl-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | CC[C@H]1CNc2cccc(Cl)c2O1 |
| InChI | InChI=1S/C10H12ClNO/c1-2-7-6-12-9-5-3-4-8(11)10(9)13-7/h3-5,7,12H,2,6H2,1H3/t7-/m0/s1 |
| InChIKey | ITEJHFNAMVPAFK-ZETCQYMHSA-N |
| XLogP | 2.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.66 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |