C15H12Cl2F2N2O — CID 87495050
[(2S)-8-(2,6-dichloro-3,5-difluorophenyl)-3,4-dihydro-2H-1,4-benzoxazin-2-yl]methanamine (PubChem CID 87495050) has the molecular formula C15H12Cl2F2N2O and a molecular weight of 345.18 g/mol. Its IUPAC name is [(2S)-8-(2,6-dichloro-3,5-difluorophenyl)-3,4-dihydro-2H-1,4-benzoxazin-2-yl]methanamine.
| Compound Name | [(2S)-8-(2,6-dichloro-3,5-difluorophenyl)-3,4-dihydro-2H-1,4-benzoxazin-2-yl]methanamine |
|---|---|
| PubChem CID | 87495050 |
| Molecular Formula | C15H12Cl2F2N2O |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | [(2S)-8-(2,6-dichloro-3,5-difluorophenyl)-3,4-dihydro-2H-1,4-benzoxazin-2-yl]methanamine |
| SMILES | NC[C@H]1CNc2cccc(-c3c(Cl)c(F)cc(F)c3Cl)c2O1 |
| InChI | InChI=1S/C15H12Cl2F2N2O/c16-13-9(18)4-10(19)14(17)12(13)8-2-1-3-11-15(8)22-7(5-20)6-21-11/h1-4,7,21H,5-6,20H2/t7-/m0/s1 |
| InChIKey | BIUNQXKFJQZHRD-ZETCQYMHSA-N |
| XLogP | 4.07 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|