About ethane;2-(2-nitrophenyl)-1,3-oxazole
ethane;2-(2-nitrophenyl)-1,3-oxazole (PubChem CID 91192753) has the molecular formula C13H18N2O3
and a molecular weight of 250.30 g/mol. Its IUPAC name is ethane;2-(2-nitrophenyl)-1,3-oxazole.
Molecular Properties
| Compound Name | ethane;2-(2-nitrophenyl)-1,3-oxazole |
| PubChem CID | 91192753 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | ethane;2-(2-nitrophenyl)-1,3-oxazole |
| SMILES | CC.CC.O=[N+]([O-])c1ccccc1-c1ncco1 |
| InChI | InChI=1S/C9H6N2O3.2C2H6/c12-11(13)8-4-2-1-3-7(8)9-10-5-6-14-9;2*1-2/h1-6H;2*1-2H3 |
| InChIKey | AEUBKCFILXEJPU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-(2-nitrophenyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(2-nitrophenyl)-1,3-oxazole?
The IUPAC name of ethane;2-(2-nitrophenyl)-1,3-oxazole (CID 91192753) is ethane;2-(2-nitrophenyl)-1,3-oxazole.
What is the SMILES notation for ethane;2-(2-nitrophenyl)-1,3-oxazole?
The canonical SMILES for ethane;2-(2-nitrophenyl)-1,3-oxazole is CC.CC.O=[N+]([O-])c1ccccc1-c1ncco1.
What is the InChIKey of ethane;2-(2-nitrophenyl)-1,3-oxazole?
The InChIKey is AEUBKCFILXEJPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O3.2C2H6/c12-11(13)8-4-2-1-3-7(8)9-10-5-6-14-9;2*1-2/h1-6H;2*1-2H3.
What are the key properties of ethane;2-(2-nitrophenyl)-1,3-oxazole?
ethane;2-(2-nitrophenyl)-1,3-oxazole has a molecular weight of 250.30 g/mol, XLogP of 4.30, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(2-nitrophenyl)-1,3-oxazole is sourced from PubChem (CID 91192753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).