C11H8N2O3 — CID 175956037
2-[2-(2-nitrophenyl)ethenyl]-1,3-oxazole (PubChem CID 175956037) has the molecular formula C11H8N2O3 and a molecular weight of 216.20 g/mol. Its IUPAC name is 2-[2-(2-nitrophenyl)ethenyl]-1,3-oxazole.
| Compound Name | 2-[2-(2-nitrophenyl)ethenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 175956037 |
| Molecular Formula | C11H8N2O3 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 2-[2-(2-nitrophenyl)ethenyl]-1,3-oxazole |
| SMILES | O=[N+]([O-])c1ccccc1C=Cc1ncco1 |
| InChI | InChI=1S/C11H8N2O3/c14-13(15)10-4-2-1-3-9(10)5-6-11-12-7-8-16-11/h1-8H |
| InChIKey | LCTKKMLYQAYXOL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|