C22H14N4O8 — CID 95239992
1,5-dinitro-4-[(Z)-2-(2-nitrophenyl)ethenyl]-2-[(E)-2-(2-nitrophenyl)ethenyl]benzene (PubChem CID 95239992) has the molecular formula C22H14N4O8 and a molecular weight of 462.37 g/mol. Its IUPAC name is 1,5-dinitro-4-[(Z)-2-(2-nitrophenyl)ethenyl]-2-[(E)-2-(2-nitrophenyl)ethenyl]benzene.
| Compound Name | 1,5-dinitro-4-[(Z)-2-(2-nitrophenyl)ethenyl]-2-[(E)-2-(2-nitrophenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 95239992 |
| Molecular Formula | C22H14N4O8 |
| Molecular Weight | 462.37 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 1,5-dinitro-4-[(Z)-2-(2-nitrophenyl)ethenyl]-2-[(E)-2-(2-nitrophenyl)ethenyl]benzene |
| SMILES | O=[N+]([O-])c1ccccc1/C=C\c1cc(/C=C/c2ccccc2[N+](=O)[O-])c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H14N4O8/c27-23(28)19-7-3-1-5-15(19)9-11-17-13-18(22(26(33)34)14-21(17)25(31)32)12-10-16-6-2-4-8-20(16)24(29)30/h1-14H/b11-9-,12-10+ |
| InChIKey | VYMJPXODFITBKT-DSOJMZEYSA-N |
| XLogP | 5.66 |
| TPSA | 172.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.37 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|