C22H13NO4 — CID 175395824
2-[(E)-2-(2-nitrophenyl)ethenyl]anthracene-9,10-dione (PubChem CID 175395824) has the molecular formula C22H13NO4 and a molecular weight of 355.35 g/mol. Its IUPAC name is 2-[(E)-2-(2-nitrophenyl)ethenyl]anthracene-9,10-dione.
| Compound Name | 2-[(E)-2-(2-nitrophenyl)ethenyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 175395824 |
| Molecular Formula | C22H13NO4 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-[(E)-2-(2-nitrophenyl)ethenyl]anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2cc(/C=C/c3ccccc3[N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C22H13NO4/c24-21-16-6-2-3-7-17(16)22(25)19-13-14(10-12-18(19)21)9-11-15-5-1-4-8-20(15)23(26)27/h1-13H/b11-9+ |
| InChIKey | XDPXKQYOGKQDEI-PKNBQFBNSA-N |
| XLogP | 4.54 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|