C11H14N3O3+ — CID 174655042
trimethyl-(4-nitro-3-oxo-1,2-dihydroisoindol-1-yl)azanium (PubChem CID 174655042) has the molecular formula C11H14N3O3+ and a molecular weight of 236.25 g/mol. Its IUPAC name is trimethyl-(4-nitro-3-oxo-1,2-dihydroisoindol-1-yl)azanium.
| Compound Name | trimethyl-(4-nitro-3-oxo-1,2-dihydroisoindol-1-yl)azanium |
|---|---|
| PubChem CID | 174655042 |
| Molecular Formula | C11H14N3O3+ |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | trimethyl-(4-nitro-3-oxo-1,2-dihydroisoindol-1-yl)azanium |
| SMILES | C[N+](C)(C)C1NC(=O)c2c1cccc2[N+](=O)[O-] |
| InChI | InChI=1S/C11H13N3O3/c1-14(2,3)10-7-5-4-6-8(13(16)17)9(7)11(15)12-10/h4-6,10H,1-3H3/p+1 |
| InChIKey | WKSWGNFQOOJRBA-UHFFFAOYSA-O |
| XLogP | 1.04 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|