C11H14OS — CID 117284873
3-(2,3-dihydro-1-benzothiophen-7-yl)propan-1-ol (PubChem CID 117284873) has the molecular formula C11H14OS and a molecular weight of 194.30 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzothiophen-7-yl)propan-1-ol.
| Compound Name | 3-(2,3-dihydro-1-benzothiophen-7-yl)propan-1-ol |
|---|---|
| PubChem CID | 117284873 |
| Molecular Formula | C11H14OS |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 3-(2,3-dihydro-1-benzothiophen-7-yl)propan-1-ol |
| SMILES | OCCCc1cccc2c1SCC2 |
| InChI | InChI=1S/C11H14OS/c12-7-2-5-9-3-1-4-10-6-8-13-11(9)10/h1,3-4,12H,2,5-8H2 |
| InChIKey | XSSCQCRLKGZYLY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |