C10H12N2O — CID 82410863
7-(2-aminoethyl)-1,3-dihydroindol-2-one (PubChem CID 82410863) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 7-(2-aminoethyl)-1,3-dihydroindol-2-one.
| Compound Name | 7-(2-aminoethyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82410863 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 7-(2-aminoethyl)-1,3-dihydroindol-2-one |
| SMILES | NCCc1cccc2c1NC(=O)C2 |
| InChI | InChI=1S/C10H12N2O/c11-5-4-7-2-1-3-8-6-9(13)12-10(7)8/h1-3H,4-6,11H2,(H,12,13) |
| InChIKey | JGFPGILWOZSIEV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |