C11H13ClN2O — CID 82190727
5-(2-aminoethyl)-6-chloro-7-methyl-1,3-dihydroindol-2-one (PubChem CID 82190727) has the molecular formula C11H13ClN2O and a molecular weight of 224.69 g/mol. Its IUPAC name is 5-(2-aminoethyl)-6-chloro-7-methyl-1,3-dihydroindol-2-one.
| Compound Name | 5-(2-aminoethyl)-6-chloro-7-methyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82190727 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 5-(2-aminoethyl)-6-chloro-7-methyl-1,3-dihydroindol-2-one |
| SMILES | Cc1c(Cl)c(CCN)cc2c1NC(=O)C2 |
| InChI | InChI=1S/C11H13ClN2O/c1-6-10(12)7(2-3-13)4-8-5-9(15)14-11(6)8/h4H,2-3,5,13H2,1H3,(H,14,15) |
| InChIKey | XZRUFWQYQYDICU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |