C16H13F2NO2 — CID 127033260
6-[2-(2,4-difluorophenyl)ethyl]-4H-1,4-benzoxazin-3-one (PubChem CID 127033260) has the molecular formula C16H13F2NO2 and a molecular weight of 289.28 g/mol. Its IUPAC name is 6-[2-(2,4-difluorophenyl)ethyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(2,4-difluorophenyl)ethyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 127033260 |
| Molecular Formula | C16H13F2NO2 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 6-[2-(2,4-difluorophenyl)ethyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(CCc3ccc(F)cc3F)cc2N1 |
| InChI | InChI=1S/C16H13F2NO2/c17-12-5-4-11(13(18)8-12)3-1-10-2-6-15-14(7-10)19-16(20)9-21-15/h2,4-8H,1,3,9H2,(H,19,20) |
| InChIKey | RSNQGKQXPUVXFF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |