C17H14F3NO2 — CID 11565976
6-[2-[2-(trifluoromethyl)phenyl]ethyl]-4H-1,4-benzoxazin-3-one (PubChem CID 11565976) has the molecular formula C17H14F3NO2 and a molecular weight of 321.30 g/mol. Its IUPAC name is 6-[2-[2-(trifluoromethyl)phenyl]ethyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-[2-(trifluoromethyl)phenyl]ethyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 11565976 |
| Molecular Formula | C17H14F3NO2 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 6-[2-[2-(trifluoromethyl)phenyl]ethyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(CCc3ccccc3C(F)(F)F)cc2N1 |
| InChI | InChI=1S/C17H14F3NO2/c18-17(19,20)13-4-2-1-3-12(13)7-5-11-6-8-15-14(9-11)21-16(22)10-23-15/h1-4,6,8-9H,5,7,10H2,(H,21,22) |
| InChIKey | BVIJQQZSKPLOHI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |