C21H18N2O7 — CID 20917476
3-(3-oxo-4H-1,4-benzoxazin-7-yl)-4-(3,4,5-trimethoxyanilino)cyclobut-3-ene-1,2-dione (PubChem CID 20917476) has the molecular formula C21H18N2O7 and a molecular weight of 410.38 g/mol. Its IUPAC name is 3-(3-oxo-4H-1,4-benzoxazin-7-yl)-4-(3,4,5-trimethoxyanilino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(3-oxo-4H-1,4-benzoxazin-7-yl)-4-(3,4,5-trimethoxyanilino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 20917476 |
| Molecular Formula | C21H18N2O7 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 3-(3-oxo-4H-1,4-benzoxazin-7-yl)-4-(3,4,5-trimethoxyanilino)cyclobut-3-ene-1,2-dione |
| SMILES | COc1cc(Nc2c(-c3ccc4c(c3)OCC(=O)N4)c(=O)c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C21H18N2O7/c1-27-14-7-11(8-15(28-2)21(14)29-3)22-18-17(19(25)20(18)26)10-4-5-12-13(6-10)30-9-16(24)23-12/h4-8,22H,9H2,1-3H3,(H,23,24) |
| InChIKey | WFVDUMXGGFVBSJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|