C20H16N2O5 — CID 20917467
3-(4-ethoxyanilino)-4-(3-oxo-4H-1,4-benzoxazin-7-yl)cyclobut-3-ene-1,2-dione (PubChem CID 20917467) has the molecular formula C20H16N2O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is 3-(4-ethoxyanilino)-4-(3-oxo-4H-1,4-benzoxazin-7-yl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(4-ethoxyanilino)-4-(3-oxo-4H-1,4-benzoxazin-7-yl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 20917467 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 3-(4-ethoxyanilino)-4-(3-oxo-4H-1,4-benzoxazin-7-yl)cyclobut-3-ene-1,2-dione |
| SMILES | CCOc1ccc(Nc2c(-c3ccc4c(c3)OCC(=O)N4)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C20H16N2O5/c1-2-26-13-6-4-12(5-7-13)21-18-17(19(24)20(18)25)11-3-8-14-15(9-11)27-10-16(23)22-14/h3-9,21H,2,10H2,1H3,(H,22,23) |
| InChIKey | IBTVNCJBHRHTTI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|