C11H11NO3 — CID 19067995
7-prop-2-enoxy-4H-1,4-benzoxazin-3-one (PubChem CID 19067995) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 7-prop-2-enoxy-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-prop-2-enoxy-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 19067995 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 7-prop-2-enoxy-4H-1,4-benzoxazin-3-one |
| SMILES | C=CCOc1ccc2c(c1)OCC(=O)N2 |
| InChI | InChI=1S/C11H11NO3/c1-2-5-14-8-3-4-9-10(6-8)15-7-11(13)12-9/h2-4,6H,1,5,7H2,(H,12,13) |
| InChIKey | YRINFJHLRKBMTK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|