C18H20N2O5 — CID 167586416
7-methoxy-4H-1,4-benzoxazin-3-one;7-methoxy-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 167586416) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 7-methoxy-4H-1,4-benzoxazin-3-one;7-methoxy-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 7-methoxy-4H-1,4-benzoxazin-3-one;7-methoxy-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 167586416 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 7-methoxy-4H-1,4-benzoxazin-3-one;7-methoxy-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | COc1ccc2c(c1)OCC(=O)N2.COc1ccc2c(c1)OCCN2 |
| InChI | InChI=1S/C9H9NO3.C9H11NO2/c1-12-6-2-3-7-8(4-6)13-5-9(11)10-7;1-11-7-2-3-8-9(6-7)12-5-4-10-8/h2-4H,5H2,1H3,(H,10,11);2-3,6,10H,4-5H2,1H3 |
| InChIKey | HWAYORMFKNMYGG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|