C18H16N2O4 — CID 75521748
7-[(5-methoxy-1-benzofuran-2-yl)methylamino]-4H-1,4-benzoxazin-3-one (PubChem CID 75521748) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is 7-[(5-methoxy-1-benzofuran-2-yl)methylamino]-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-[(5-methoxy-1-benzofuran-2-yl)methylamino]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 75521748 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 7-[(5-methoxy-1-benzofuran-2-yl)methylamino]-4H-1,4-benzoxazin-3-one |
| SMILES | COc1ccc2oc(CNc3ccc4c(c3)OCC(=O)N4)cc2c1 |
| InChI | InChI=1S/C18H16N2O4/c1-22-13-3-5-16-11(6-13)7-14(24-16)9-19-12-2-4-15-17(8-12)23-10-18(21)20-15/h2-8,19H,9-10H2,1H3,(H,20,21) |
| InChIKey | BZUHIEQYBQNFGC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |