C22H17N5O3 — CID 71180918
7-[(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)amino]-4H-1,4-benzoxazin-3-one (PubChem CID 71180918) has the molecular formula C22H17N5O3 and a molecular weight of 399.41 g/mol. Its IUPAC name is 7-[(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)amino]-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-[(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)amino]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 71180918 |
| Molecular Formula | C22H17N5O3 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 7-[(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)amino]-4H-1,4-benzoxazin-3-one |
| SMILES | COc1ccc2nc(-c3cccnc3)nc(Nc3ccc4c(c3)OCC(=O)N4)c2c1 |
| InChI | InChI=1S/C22H17N5O3/c1-29-15-5-7-17-16(10-15)22(27-21(26-17)13-3-2-8-23-11-13)24-14-4-6-18-19(9-14)30-12-20(28)25-18/h2-11H,12H2,1H3,(H,25,28)(H,24,26,27) |
| InChIKey | PBZZSWJNDYNKHY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |