C23H16N4O3 — CID 89417197
7-[(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)amino]chromen-2-one (PubChem CID 89417197) has the molecular formula C23H16N4O3 and a molecular weight of 396.41 g/mol. Its IUPAC name is 7-[(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)amino]chromen-2-one.
| Compound Name | 7-[(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)amino]chromen-2-one |
|---|---|
| PubChem CID | 89417197 |
| Molecular Formula | C23H16N4O3 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 7-[(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)amino]chromen-2-one |
| SMILES | COc1ccc2nc(-c3cccnc3)nc(Nc3ccc4ccc(=O)oc4c3)c2c1 |
| InChI | InChI=1S/C23H16N4O3/c1-29-17-7-8-19-18(12-17)23(27-22(26-19)15-3-2-10-24-13-15)25-16-6-4-14-5-9-21(28)30-20(14)11-16/h2-13H,1H3,(H,25,26,27) |
| InChIKey | RIWAOBOXPZRIDX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|