C12H12N4O2 — CID 75521753
7-(1H-pyrazol-5-ylmethylamino)-4H-1,4-benzoxazin-3-one (PubChem CID 75521753) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is 7-(1H-pyrazol-5-ylmethylamino)-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-(1H-pyrazol-5-ylmethylamino)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 75521753 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 7-(1H-pyrazol-5-ylmethylamino)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cc(NCc3ccn[nH]3)ccc2N1 |
| InChI | InChI=1S/C12H12N4O2/c17-12-7-18-11-5-8(1-2-10(11)15-12)13-6-9-3-4-14-16-9/h1-5,13H,6-7H2,(H,14,16)(H,15,17) |
| InChIKey | JTEVMRPGONLLSL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |