C14H14N4O2 — CID 62747139
6-[(2-methylpyrimidin-4-yl)methylamino]-4H-1,4-benzoxazin-3-one (PubChem CID 62747139) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 6-[(2-methylpyrimidin-4-yl)methylamino]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(2-methylpyrimidin-4-yl)methylamino]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 62747139 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 6-[(2-methylpyrimidin-4-yl)methylamino]-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1nccc(CNc2ccc3c(c2)NC(=O)CO3)n1 |
| InChI | InChI=1S/C14H14N4O2/c1-9-15-5-4-11(17-9)7-16-10-2-3-13-12(6-10)18-14(19)8-20-13/h2-6,16H,7-8H2,1H3,(H,18,19) |
| InChIKey | WSCFOMQWQBCZTI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|