C11H15NO2 — CID 117246836
8-methoxy-3,4,5,6-tetrahydro-2H-1,6-benzoxazocine (PubChem CID 117246836) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 8-methoxy-3,4,5,6-tetrahydro-2H-1,6-benzoxazocine.
| Compound Name | 8-methoxy-3,4,5,6-tetrahydro-2H-1,6-benzoxazocine |
|---|---|
| PubChem CID | 117246836 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 8-methoxy-3,4,5,6-tetrahydro-2H-1,6-benzoxazocine |
| SMILES | COc1ccc2c(c1)NCCCCO2 |
| InChI | InChI=1S/C11H15NO2/c1-13-9-4-5-11-10(8-9)12-6-2-3-7-14-11/h4-5,8,12H,2-3,6-7H2,1H3 |
| InChIKey | UQLAFQQKSZWLEA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |