C11H16N2O2 — CID 82241529
(7-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)hydrazine (PubChem CID 82241529) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is (7-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)hydrazine.
| Compound Name | (7-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)hydrazine |
|---|---|
| PubChem CID | 82241529 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | (7-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)hydrazine |
| SMILES | COc1ccc2c(c1)C(NN)CCCO2 |
| InChI | InChI=1S/C11H16N2O2/c1-14-8-4-5-11-9(7-8)10(13-12)3-2-6-15-11/h4-5,7,10,13H,2-3,6,12H2,1H3 |
| InChIKey | WEQDDLVQTLIYCH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|