C23H28N2O6 — CID 70473777
6-[2-[[2-hydroxy-3-(2-prop-2-enoxyphenoxy)propyl]amino]propoxy]-4H-1,4-benzoxazin-3-one (PubChem CID 70473777) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is 6-[2-[[2-hydroxy-3-(2-prop-2-enoxyphenoxy)propyl]amino]propoxy]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-[[2-hydroxy-3-(2-prop-2-enoxyphenoxy)propyl]amino]propoxy]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 70473777 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 6-[2-[[2-hydroxy-3-(2-prop-2-enoxyphenoxy)propyl]amino]propoxy]-4H-1,4-benzoxazin-3-one |
| SMILES | C=CCOc1ccccc1OCC(O)CNC(C)COc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C23H28N2O6/c1-3-10-28-21-6-4-5-7-22(21)30-14-17(26)12-24-16(2)13-29-18-8-9-20-19(11-18)25-23(27)15-31-20/h3-9,11,16-17,24,26H,1,10,12-15H2,2H3,(H,25,27) |
| InChIKey | IHLYUMIMUFOPBE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|