C16H15NO4 — CID 61082603
6-[hydroxy-(2-methoxyphenyl)methyl]-4H-1,4-benzoxazin-3-one (PubChem CID 61082603) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is 6-[hydroxy-(2-methoxyphenyl)methyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[hydroxy-(2-methoxyphenyl)methyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 61082603 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 6-[hydroxy-(2-methoxyphenyl)methyl]-4H-1,4-benzoxazin-3-one |
| SMILES | COc1ccccc1C(O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C16H15NO4/c1-20-13-5-3-2-4-11(13)16(19)10-6-7-14-12(8-10)17-15(18)9-21-14/h2-8,16,19H,9H2,1H3,(H,17,18) |
| InChIKey | BMJFOYSZBXPHTI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |