C12H11N3O3 — CID 114992868
6-[hydroxy(1H-pyrazol-5-yl)methyl]-4H-1,4-benzoxazin-3-one (PubChem CID 114992868) has the molecular formula C12H11N3O3 and a molecular weight of 245.24 g/mol. Its IUPAC name is 6-[hydroxy(1H-pyrazol-5-yl)methyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[hydroxy(1H-pyrazol-5-yl)methyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 114992868 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 6-[hydroxy(1H-pyrazol-5-yl)methyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(C(O)c3ccn[nH]3)cc2N1 |
| InChI | InChI=1S/C12H11N3O3/c16-11-6-18-10-2-1-7(5-9(10)14-11)12(17)8-3-4-13-15-8/h1-5,12,17H,6H2,(H,13,15)(H,14,16) |
| InChIKey | YINTXYLQFKPPIJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |