C13H10BrNO3S — CID 63797489
6-[(3-bromothiophen-2-yl)-hydroxymethyl]-4H-1,4-benzoxazin-3-one (PubChem CID 63797489) has the molecular formula C13H10BrNO3S and a molecular weight of 340.20 g/mol. Its IUPAC name is 6-[(3-bromothiophen-2-yl)-hydroxymethyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(3-bromothiophen-2-yl)-hydroxymethyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 63797489 |
| Molecular Formula | C13H10BrNO3S |
| Molecular Weight | 340.20 g/mol |
| Exact Mass | 338.96 |
| IUPAC Name | 6-[(3-bromothiophen-2-yl)-hydroxymethyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(C(O)c3sccc3Br)cc2N1 |
| InChI | InChI=1S/C13H10BrNO3S/c14-8-3-4-19-13(8)12(17)7-1-2-10-9(5-7)15-11(16)6-18-10/h1-5,12,17H,6H2,(H,15,16) |
| InChIKey | JFDMOIDWSYGOLN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.20 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |