C14H14N2O2S — CID 43464762
6-[amino-(3-methylthiophen-2-yl)methyl]-4H-1,4-benzoxazin-3-one (PubChem CID 43464762) has the molecular formula C14H14N2O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is 6-[amino-(3-methylthiophen-2-yl)methyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[amino-(3-methylthiophen-2-yl)methyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 43464762 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 6-[amino-(3-methylthiophen-2-yl)methyl]-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1ccsc1C(N)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C14H14N2O2S/c1-8-4-5-19-14(8)13(15)9-2-3-11-10(6-9)16-12(17)7-18-11/h2-6,13H,7,15H2,1H3,(H,16,17) |
| InChIKey | SPXWGKCIEVMQRY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |