C20H23N3O2 — CID 167300314
7-[4-(4-methylpiperidin-1-yl)anilino]-4H-1,4-benzoxazin-3-one (PubChem CID 167300314) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 7-[4-(4-methylpiperidin-1-yl)anilino]-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-[4-(4-methylpiperidin-1-yl)anilino]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 167300314 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 7-[4-(4-methylpiperidin-1-yl)anilino]-4H-1,4-benzoxazin-3-one |
| SMILES | CC1CCN(c2ccc(Nc3ccc4c(c3)OCC(=O)N4)cc2)CC1 |
| InChI | InChI=1S/C20H23N3O2/c1-14-8-10-23(11-9-14)17-5-2-15(3-6-17)21-16-4-7-18-19(12-16)25-13-20(24)22-18/h2-7,12,14,21H,8-11,13H2,1H3,(H,22,24) |
| InChIKey | LCSFHTKGSCYNRV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|