C20H22N4O3 — CID 78893392
1-(3-oxo-4H-1,4-benzoxazin-7-yl)-3-[(1-phenylpyrrolidin-3-yl)methyl]urea (PubChem CID 78893392) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 1-(3-oxo-4H-1,4-benzoxazin-7-yl)-3-[(1-phenylpyrrolidin-3-yl)methyl]urea.
| Compound Name | 1-(3-oxo-4H-1,4-benzoxazin-7-yl)-3-[(1-phenylpyrrolidin-3-yl)methyl]urea |
|---|---|
| PubChem CID | 78893392 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-(3-oxo-4H-1,4-benzoxazin-7-yl)-3-[(1-phenylpyrrolidin-3-yl)methyl]urea |
| SMILES | O=C1COc2cc(NC(=O)NCC3CCN(c4ccccc4)C3)ccc2N1 |
| InChI | InChI=1S/C20H22N4O3/c25-19-13-27-18-10-15(6-7-17(18)23-19)22-20(26)21-11-14-8-9-24(12-14)16-4-2-1-3-5-16/h1-7,10,14H,8-9,11-13H2,(H,23,25)(H2,21,22,26) |
| InChIKey | OWSKIEZGQVHCQJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |