C18H20N4O3 — CID 78893272
1-[[4-(dimethylamino)phenyl]methyl]-3-(3-oxo-4H-1,4-benzoxazin-7-yl)urea (PubChem CID 78893272) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]methyl]-3-(3-oxo-4H-1,4-benzoxazin-7-yl)urea.
| Compound Name | 1-[[4-(dimethylamino)phenyl]methyl]-3-(3-oxo-4H-1,4-benzoxazin-7-yl)urea |
|---|---|
| PubChem CID | 78893272 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]methyl]-3-(3-oxo-4H-1,4-benzoxazin-7-yl)urea |
| SMILES | CN(C)c1ccc(CNC(=O)Nc2ccc3c(c2)OCC(=O)N3)cc1 |
| InChI | InChI=1S/C18H20N4O3/c1-22(2)14-6-3-12(4-7-14)10-19-18(24)20-13-5-8-15-16(9-13)25-11-17(23)21-15/h3-9H,10-11H2,1-2H3,(H,21,23)(H2,19,20,24) |
| InChIKey | TUIZNIXPQKFWMX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|