C14H19N3O3 — CID 78893078
1-(3-methylbutyl)-3-(3-oxo-4H-1,4-benzoxazin-7-yl)urea (PubChem CID 78893078) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 1-(3-methylbutyl)-3-(3-oxo-4H-1,4-benzoxazin-7-yl)urea.
| Compound Name | 1-(3-methylbutyl)-3-(3-oxo-4H-1,4-benzoxazin-7-yl)urea |
|---|---|
| PubChem CID | 78893078 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 1-(3-methylbutyl)-3-(3-oxo-4H-1,4-benzoxazin-7-yl)urea |
| SMILES | CC(C)CCNC(=O)Nc1ccc2c(c1)OCC(=O)N2 |
| InChI | InChI=1S/C14H19N3O3/c1-9(2)5-6-15-14(19)16-10-3-4-11-12(7-10)20-8-13(18)17-11/h3-4,7,9H,5-6,8H2,1-2H3,(H,17,18)(H2,15,16,19) |
| InChIKey | SYGKCMXLVVYUCA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |