C19H17N3O4 — CID 78893273
1-[1-(1-benzofuran-2-yl)ethyl]-3-(3-oxo-4H-1,4-benzoxazin-7-yl)urea (PubChem CID 78893273) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is 1-[1-(1-benzofuran-2-yl)ethyl]-3-(3-oxo-4H-1,4-benzoxazin-7-yl)urea.
| Compound Name | 1-[1-(1-benzofuran-2-yl)ethyl]-3-(3-oxo-4H-1,4-benzoxazin-7-yl)urea |
|---|---|
| PubChem CID | 78893273 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 1-[1-(1-benzofuran-2-yl)ethyl]-3-(3-oxo-4H-1,4-benzoxazin-7-yl)urea |
| SMILES | CC(NC(=O)Nc1ccc2c(c1)OCC(=O)N2)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H17N3O4/c1-11(16-8-12-4-2-3-5-15(12)26-16)20-19(24)21-13-6-7-14-17(9-13)25-10-18(23)22-14/h2-9,11H,10H2,1H3,(H,22,23)(H2,20,21,24) |
| InChIKey | VJAPVPFWFWFVGU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |