C17H13N3O3 — CID 59802843
N-(3-oxo-4H-1,4-benzoxazin-7-yl)-1H-indole-2-carboxamide (PubChem CID 59802843) has the molecular formula C17H13N3O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is N-(3-oxo-4H-1,4-benzoxazin-7-yl)-1H-indole-2-carboxamide.
| Compound Name | N-(3-oxo-4H-1,4-benzoxazin-7-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 59802843 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-(3-oxo-4H-1,4-benzoxazin-7-yl)-1H-indole-2-carboxamide |
| SMILES | O=C1COc2cc(NC(=O)c3cc4ccccc4[nH]3)ccc2N1 |
| InChI | InChI=1S/C17H13N3O3/c21-16-9-23-15-8-11(5-6-13(15)20-16)18-17(22)14-7-10-3-1-2-4-12(10)19-14/h1-8,19H,9H2,(H,18,22)(H,20,21) |
| InChIKey | KMLOLIBDCQHWCI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |