C22H25N3O3 — CID 47033511
N-[4-[1-(1-benzofuran-2-yl)ethylcarbamoylamino]phenyl]-3-methylbutanamide (PubChem CID 47033511) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[4-[1-(1-benzofuran-2-yl)ethylcarbamoylamino]phenyl]-3-methylbutanamide.
| Compound Name | N-[4-[1-(1-benzofuran-2-yl)ethylcarbamoylamino]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 47033511 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[4-[1-(1-benzofuran-2-yl)ethylcarbamoylamino]phenyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1ccc(NC(=O)NC(C)c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C22H25N3O3/c1-14(2)12-21(26)24-17-8-10-18(11-9-17)25-22(27)23-15(3)20-13-16-6-4-5-7-19(16)28-20/h4-11,13-15H,12H2,1-3H3,(H,24,26)(H2,23,25,27) |
| InChIKey | YKVYOLOBTRVTAJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |