C19H21N3O3 — CID 167300352
7-[4-(3-methoxyazetidin-1-yl)-2-methylanilino]-4H-1,4-benzoxazin-3-one (PubChem CID 167300352) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 7-[4-(3-methoxyazetidin-1-yl)-2-methylanilino]-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-[4-(3-methoxyazetidin-1-yl)-2-methylanilino]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 167300352 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 7-[4-(3-methoxyazetidin-1-yl)-2-methylanilino]-4H-1,4-benzoxazin-3-one |
| SMILES | COC1CN(c2ccc(Nc3ccc4c(c3)OCC(=O)N4)c(C)c2)C1 |
| InChI | InChI=1S/C19H21N3O3/c1-12-7-14(22-9-15(10-22)24-2)4-6-16(12)20-13-3-5-17-18(8-13)25-11-19(23)21-17/h3-8,15,20H,9-11H2,1-2H3,(H,21,23) |
| InChIKey | UXOXLCRFDLUOBC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|