C20H20F3N3O2 — CID 167299803
8-[2-methyl-4-[3-(trifluoromethyl)azetidin-1-yl]anilino]-3,5-dihydro-2H-1,5-benzoxazepin-4-one (PubChem CID 167299803) has the molecular formula C20H20F3N3O2 and a molecular weight of 391.39 g/mol. Its IUPAC name is 8-[2-methyl-4-[3-(trifluoromethyl)azetidin-1-yl]anilino]-3,5-dihydro-2H-1,5-benzoxazepin-4-one.
| Compound Name | 8-[2-methyl-4-[3-(trifluoromethyl)azetidin-1-yl]anilino]-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 167299803 |
| Molecular Formula | C20H20F3N3O2 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 8-[2-methyl-4-[3-(trifluoromethyl)azetidin-1-yl]anilino]-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
| SMILES | Cc1cc(N2CC(C(F)(F)F)C2)ccc1Nc1ccc2c(c1)OCCC(=O)N2 |
| InChI | InChI=1S/C20H20F3N3O2/c1-12-8-15(26-10-13(11-26)20(21,22)23)3-5-16(12)24-14-2-4-17-18(9-14)28-7-6-19(27)25-17/h2-5,8-9,13,24H,6-7,10-11H2,1H3,(H,25,27) |
| InChIKey | BSNBARLCIMYKBZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|