C23H25F3N4O — CID 167299844
1-methyl-6-[2-methyl-4-[4-(trifluoromethyl)piperidin-1-yl]anilino]indole-3-carboxamide (PubChem CID 167299844) has the molecular formula C23H25F3N4O and a molecular weight of 430.47 g/mol. Its IUPAC name is 1-methyl-6-[2-methyl-4-[4-(trifluoromethyl)piperidin-1-yl]anilino]indole-3-carboxamide.
| Compound Name | 1-methyl-6-[2-methyl-4-[4-(trifluoromethyl)piperidin-1-yl]anilino]indole-3-carboxamide |
|---|---|
| PubChem CID | 167299844 |
| Molecular Formula | C23H25F3N4O |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 1-methyl-6-[2-methyl-4-[4-(trifluoromethyl)piperidin-1-yl]anilino]indole-3-carboxamide |
| SMILES | Cc1cc(N2CCC(C(F)(F)F)CC2)ccc1Nc1ccc2c(C(N)=O)cn(C)c2c1 |
| InChI | InChI=1S/C23H25F3N4O/c1-14-11-17(30-9-7-15(8-10-30)23(24,25)26)4-6-20(14)28-16-3-5-18-19(22(27)31)13-29(2)21(18)12-16/h3-6,11-13,15,28H,7-10H2,1-2H3,(H2,27,31) |
| InChIKey | PKYNFSUCSLLNAE-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 63.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|