C21H24F3N3O2 — CID 167300445
2-[2-(methylamino)-5-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]phenoxy]acetaldehyde (PubChem CID 167300445) has the molecular formula C21H24F3N3O2 and a molecular weight of 407.44 g/mol. Its IUPAC name is 2-[2-(methylamino)-5-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]phenoxy]acetaldehyde.
| Compound Name | 2-[2-(methylamino)-5-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]phenoxy]acetaldehyde |
|---|---|
| PubChem CID | 167300445 |
| Molecular Formula | C21H24F3N3O2 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-[2-(methylamino)-5-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]phenoxy]acetaldehyde |
| SMILES | CNc1ccc(Nc2ccc(N3CCC(C(F)(F)F)CC3)cc2)cc1OCC=O |
| InChI | InChI=1S/C21H24F3N3O2/c1-25-19-7-4-17(14-20(19)29-13-12-28)26-16-2-5-18(6-3-16)27-10-8-15(9-11-27)21(22,23)24/h2-7,12,14-15,25-26H,8-11,13H2,1H3 |
| InChIKey | SSJQEXBDHPIRMC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|