C21H27N3O3 — CID 167300720
2-[5-[4-(3-methoxy-3-methylazetidin-1-yl)-2-methylanilino]-2-(methylamino)phenoxy]acetaldehyde (PubChem CID 167300720) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 2-[5-[4-(3-methoxy-3-methylazetidin-1-yl)-2-methylanilino]-2-(methylamino)phenoxy]acetaldehyde.
| Compound Name | 2-[5-[4-(3-methoxy-3-methylazetidin-1-yl)-2-methylanilino]-2-(methylamino)phenoxy]acetaldehyde |
|---|---|
| PubChem CID | 167300720 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 2-[5-[4-(3-methoxy-3-methylazetidin-1-yl)-2-methylanilino]-2-(methylamino)phenoxy]acetaldehyde |
| SMILES | CNc1ccc(Nc2ccc(N3CC(C)(OC)C3)cc2C)cc1OCC=O |
| InChI | InChI=1S/C21H27N3O3/c1-15-11-17(24-13-21(2,14-24)26-4)6-8-18(15)23-16-5-7-19(22-3)20(12-16)27-10-9-25/h5-9,11-12,22-23H,10,13-14H2,1-4H3 |
| InChIKey | AQAKLSUWGAZVBP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|