C24H27F3N4O2 — CID 171615105
tert-butyl 6-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]indazole-1-carboxylate (PubChem CID 171615105) has the molecular formula C24H27F3N4O2 and a molecular weight of 460.50 g/mol. Its IUPAC name is tert-butyl 6-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]indazole-1-carboxylate.
| Compound Name | tert-butyl 6-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]indazole-1-carboxylate |
|---|---|
| PubChem CID | 171615105 |
| Molecular Formula | C24H27F3N4O2 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | tert-butyl 6-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ncc2ccc(Nc3ccc(N4CCC(C(F)(F)F)CC4)cc3)cc21 |
| InChI | InChI=1S/C24H27F3N4O2/c1-23(2,3)33-22(32)31-21-14-19(5-4-16(21)15-28-31)29-18-6-8-20(9-7-18)30-12-10-17(11-13-30)24(25,26)27/h4-9,14-15,17,29H,10-13H2,1-3H3 |
| InChIKey | KZDFGOVLJUNPTP-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|