C25H31F2N5O3S — CID 143370581
tert-butyl 5-[[1-[4-[(1-fluoro-1-fluorooxyethyl)sulfanylamino]phenyl]piperidin-3-yl]amino]indazole-1-carboxylate (PubChem CID 143370581) has the molecular formula C25H31F2N5O3S and a molecular weight of 519.62 g/mol. Its IUPAC name is tert-butyl 5-[[1-[4-[(1-fluoro-1-fluorooxyethyl)sulfanylamino]phenyl]piperidin-3-yl]amino]indazole-1-carboxylate.
| Compound Name | tert-butyl 5-[[1-[4-[(1-fluoro-1-fluorooxyethyl)sulfanylamino]phenyl]piperidin-3-yl]amino]indazole-1-carboxylate |
|---|---|
| PubChem CID | 143370581 |
| Molecular Formula | C25H31F2N5O3S |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | tert-butyl 5-[[1-[4-[(1-fluoro-1-fluorooxyethyl)sulfanylamino]phenyl]piperidin-3-yl]amino]indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ncc2cc(NC3CCCN(c4ccc(NSC(C)(F)OF)cc4)C3)ccc21 |
| InChI | InChI=1S/C25H31F2N5O3S/c1-24(2,3)34-23(33)32-22-12-9-19(14-17(22)15-28-32)29-20-6-5-13-31(16-20)21-10-7-18(8-11-21)30-36-25(4,26)35-27/h7-12,14-15,20,29-30H,5-6,13,16H2,1-4H3 |
| InChIKey | HLUSKUFPKJTRAX-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|