C24H30N4O2 — CID 70979242
tert-butyl 5-[(1-benzylpiperidin-3-yl)amino]indazole-1-carboxylate (PubChem CID 70979242) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is tert-butyl 5-[(1-benzylpiperidin-3-yl)amino]indazole-1-carboxylate.
| Compound Name | tert-butyl 5-[(1-benzylpiperidin-3-yl)amino]indazole-1-carboxylate |
|---|---|
| PubChem CID | 70979242 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | tert-butyl 5-[(1-benzylpiperidin-3-yl)amino]indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ncc2cc(NC3CCCN(Cc4ccccc4)C3)ccc21 |
| InChI | InChI=1S/C24H30N4O2/c1-24(2,3)30-23(29)28-22-12-11-20(14-19(22)15-25-28)26-21-10-7-13-27(17-21)16-18-8-5-4-6-9-18/h4-6,8-9,11-12,14-15,21,26H,7,10,13,16-17H2,1-3H3 |
| InChIKey | XDNJXZLCSCGGAB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |