C25H35N5O3 — CID 143370372
tert-butyl 5-[[1-(4-acetamidophenyl)piperidin-3-yl]amino]indazole-1-carboxylate;molecular hydrogen (PubChem CID 143370372) has the molecular formula C25H35N5O3 and a molecular weight of 453.59 g/mol. Its IUPAC name is tert-butyl 5-[[1-(4-acetamidophenyl)piperidin-3-yl]amino]indazole-1-carboxylate;molecular hydrogen.
| Compound Name | tert-butyl 5-[[1-(4-acetamidophenyl)piperidin-3-yl]amino]indazole-1-carboxylate;molecular hydrogen |
|---|---|
| PubChem CID | 143370372 |
| Molecular Formula | C25H35N5O3 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | tert-butyl 5-[[1-(4-acetamidophenyl)piperidin-3-yl]amino]indazole-1-carboxylate;molecular hydrogen |
| SMILES | CC(=O)Nc1ccc(N2CCCC(Nc3ccc4c(cnn4C(=O)OC(C)(C)C)c3)C2)cc1.[H][H].[H][H] |
| InChI | InChI=1S/C25H31N5O3.2H2/c1-17(31)27-19-7-10-22(11-8-19)29-13-5-6-21(16-29)28-20-9-12-23-18(14-20)15-26-30(23)24(32)33-25(2,3)4;;/h7-12,14-15,21,28H,5-6,13,16H2,1-4H3,(H,27,31);2*1H |
| InChIKey | QDOPKJBTTAGDJD-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|