C12H14N2O3 — CID 118798018
tert-butyl 5-hydroxyindazole-1-carboxylate (PubChem CID 118798018) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is tert-butyl 5-hydroxyindazole-1-carboxylate.
| Compound Name | tert-butyl 5-hydroxyindazole-1-carboxylate |
|---|---|
| PubChem CID | 118798018 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | tert-butyl 5-hydroxyindazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ncc2cc(O)ccc21 |
| InChI | InChI=1S/C12H14N2O3/c1-12(2,3)17-11(16)14-10-5-4-9(15)6-8(10)7-13-14/h4-7,15H,1-3H3 |
| InChIKey | RUVAJUODOYPQDW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |