C17H18N4O3 — CID 53418182
tert-butyl 5-(pyrimidin-2-yloxymethyl)indazole-1-carboxylate (PubChem CID 53418182) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is tert-butyl 5-(pyrimidin-2-yloxymethyl)indazole-1-carboxylate.
| Compound Name | tert-butyl 5-(pyrimidin-2-yloxymethyl)indazole-1-carboxylate |
|---|---|
| PubChem CID | 53418182 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | tert-butyl 5-(pyrimidin-2-yloxymethyl)indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ncc2cc(COc3ncccn3)ccc21 |
| InChI | InChI=1S/C17H18N4O3/c1-17(2,3)24-16(22)21-14-6-5-12(9-13(14)10-20-21)11-23-15-18-7-4-8-19-15/h4-10H,11H2,1-3H3 |
| InChIKey | LPOIDKLSUIPGGM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |